C18H24Cl2O — CID 115927181
2-[3-chloro-2-(chloromethyl)-2-cyclopentylpropyl]-5-methyl-2,3-dihydro-1-benzofuran (PubChem CID 115927181) has the molecular formula C18H24Cl2O and a molecular weight of 327.29 g/mol. Its IUPAC name is 2-[3-chloro-2-(chloromethyl)-2-cyclopentylpropyl]-5-methyl-2,3-dihydro-1-benzofuran.
| Compound Name | 2-[3-chloro-2-(chloromethyl)-2-cyclopentylpropyl]-5-methyl-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 115927181 |
| Molecular Formula | C18H24Cl2O |
| Molecular Weight | 327.29 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 2-[3-chloro-2-(chloromethyl)-2-cyclopentylpropyl]-5-methyl-2,3-dihydro-1-benzofuran |
| SMILES | Cc1ccc2c(c1)CC(CC(CCl)(CCl)C1CCCC1)O2 |
| InChI | InChI=1S/C18H24Cl2O/c1-13-6-7-17-14(8-13)9-16(21-17)10-18(11-19,12-20)15-4-2-3-5-15/h6-8,15-16H,2-5,9-12H2,1H3 |
| InChIKey | POAULYBZCSDVAO-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.29 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|