C10H9NO — CID 83480135
5-isocyano-2-methyl-2,3-dihydro-1-benzofuran (PubChem CID 83480135) has the molecular formula C10H9NO and a molecular weight of 159.19 g/mol. Its IUPAC name is 5-isocyano-2-methyl-2,3-dihydro-1-benzofuran.
| Compound Name | 5-isocyano-2-methyl-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 83480135 |
| Molecular Formula | C10H9NO |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.07 |
| IUPAC Name | 5-isocyano-2-methyl-2,3-dihydro-1-benzofuran |
| SMILES | [C-]#[N+]c1ccc2c(c1)CC(C)O2 |
| InChI | InChI=1S/C10H9NO/c1-7-5-8-6-9(11-2)3-4-10(8)12-7/h3-4,6-7H,5H2,1H3 |
| InChIKey | SZWARFXONPMPCW-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 13.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|