2-methyl-2,3-dihydro-1-benzofuran-5-sulfonyl fluoride

C9H9FO3S — CID 165460112

IUPAC2-methyl-2,3-dihydro-1-benzofuran-5-sulfonyl fluoride
SMILESCC1Cc2cc(S(=O)(=O)F)ccc2O1
InChIInChI=1S/C9H9FO3S/c1-6-4-7-5-8(14(10,11)12)2-3-9(7)13-6/h2-3,5-6H,4H2,1H3
InChIKeyGSNDZSKDPGOEJO-UHFFFAOYSA-N
MW216.23 g/mol
LogP1.67
Rot. Bonds1

About 2-methyl-2,3-dihydro-1-benzofuran-5-sulfonyl fluoride

2-methyl-2,3-dihydro-1-benzofuran-5-sulfonyl fluoride (PubChem CID 165460112) has the molecular formula C9H9FO3S and a molecular weight of 216.23 g/mol. Its IUPAC name is 2-methyl-2,3-dihydro-1-benzofuran-5-sulfonyl fluoride.

Molecular Properties

Compound Name2-methyl-2,3-dihydro-1-benzofuran-5-sulfonyl fluoride
PubChem CID165460112
Molecular FormulaC9H9FO3S
Molecular Weight216.23 g/mol
Exact Mass216.03
IUPAC Name2-methyl-2,3-dihydro-1-benzofuran-5-sulfonyl fluoride
SMILESCC1Cc2cc(S(=O)(=O)F)ccc2O1
InChIInChI=1S/C9H9FO3S/c1-6-4-7-5-8(14(10,11)12)2-3-9(7)13-6/h2-3,5-6H,4H2,1H3
InChIKeyGSNDZSKDPGOEJO-UHFFFAOYSA-N
XLogP1.67
TPSA43.37 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500216.23
LogP ≤ 51.67
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze 2-methyl-2,3-dihydro-1-benzofuran-5-sulfonyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methyl-2,3-dihydro-1-benzofuran-5-sulfonyl fluoride?
The IUPAC name of 2-methyl-2,3-dihydro-1-benzofuran-5-sulfonyl fluoride (CID 165460112) is 2-methyl-2,3-dihydro-1-benzofuran-5-sulfonyl fluoride.
What is the SMILES notation for 2-methyl-2,3-dihydro-1-benzofuran-5-sulfonyl fluoride?
The canonical SMILES for 2-methyl-2,3-dihydro-1-benzofuran-5-sulfonyl fluoride is CC1Cc2cc(S(=O)(=O)F)ccc2O1.
What is the InChIKey of 2-methyl-2,3-dihydro-1-benzofuran-5-sulfonyl fluoride?
The InChIKey is GSNDZSKDPGOEJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9FO3S/c1-6-4-7-5-8(14(10,11)12)2-3-9(7)13-6/h2-3,5-6H,4H2,1H3.
What are the key properties of 2-methyl-2,3-dihydro-1-benzofuran-5-sulfonyl fluoride?
2-methyl-2,3-dihydro-1-benzofuran-5-sulfonyl fluoride has a molecular weight of 216.23 g/mol, XLogP of 1.67, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2,3-dihydro-1-benzofuran-5-sulfonyl fluoride is sourced from PubChem (CID 165460112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).