About 2-methyl-2,3-dihydro-1-benzofuran-5-sulfonyl fluoride
2-methyl-2,3-dihydro-1-benzofuran-5-sulfonyl fluoride (PubChem CID 165460112) has the molecular formula C9H9FO3S
and a molecular weight of 216.23 g/mol. Its IUPAC name is 2-methyl-2,3-dihydro-1-benzofuran-5-sulfonyl fluoride.
Analyze 2-methyl-2,3-dihydro-1-benzofuran-5-sulfonyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-2,3-dihydro-1-benzofuran-5-sulfonyl fluoride?
The IUPAC name of 2-methyl-2,3-dihydro-1-benzofuran-5-sulfonyl fluoride (CID 165460112) is 2-methyl-2,3-dihydro-1-benzofuran-5-sulfonyl fluoride.
What is the SMILES notation for 2-methyl-2,3-dihydro-1-benzofuran-5-sulfonyl fluoride?
The canonical SMILES for 2-methyl-2,3-dihydro-1-benzofuran-5-sulfonyl fluoride is CC1Cc2cc(S(=O)(=O)F)ccc2O1.
What is the InChIKey of 2-methyl-2,3-dihydro-1-benzofuran-5-sulfonyl fluoride?
The InChIKey is GSNDZSKDPGOEJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9FO3S/c1-6-4-7-5-8(14(10,11)12)2-3-9(7)13-6/h2-3,5-6H,4H2,1H3.
What are the key properties of 2-methyl-2,3-dihydro-1-benzofuran-5-sulfonyl fluoride?
2-methyl-2,3-dihydro-1-benzofuran-5-sulfonyl fluoride has a molecular weight of 216.23 g/mol, XLogP of 1.67, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2,3-dihydro-1-benzofuran-5-sulfonyl fluoride is sourced from PubChem (CID 165460112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).