C10H9O3- — CID 7106477
(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-carboxylate (PubChem CID 7106477) has the molecular formula C10H9O3- and a molecular weight of 177.18 g/mol. Its IUPAC name is (2S)-2-methyl-2,3-dihydro-1-benzofuran-5-carboxylate.
| Compound Name | (2S)-2-methyl-2,3-dihydro-1-benzofuran-5-carboxylate |
|---|---|
| PubChem CID | 7106477 |
| Molecular Formula | C10H9O3- |
| Molecular Weight | 177.18 g/mol |
| Exact Mass | 177.06 |
| IUPAC Name | (2S)-2-methyl-2,3-dihydro-1-benzofuran-5-carboxylate |
| SMILES | C[C@H]1Cc2cc(C(=O)[O-])ccc2O1 |
| InChI | InChI=1S/C10H10O3/c1-6-4-8-5-7(10(11)12)2-3-9(8)13-6/h2-3,5-6H,4H2,1H3,(H,11,12)/p-1/t6-/m0/s1 |
| InChIKey | NXNQXQFRCVUXIN-LURJTMIESA-M |
| XLogP | 0.37 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.18 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |