C12H10F4O2 — CID 114032796
2,2,3,3-tetrafluoro-1-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)propan-1-one (PubChem CID 114032796) has the molecular formula C12H10F4O2 and a molecular weight of 262.20 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-1-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)propan-1-one.
| Compound Name | 2,2,3,3-tetrafluoro-1-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)propan-1-one |
|---|---|
| PubChem CID | 114032796 |
| Molecular Formula | C12H10F4O2 |
| Molecular Weight | 262.20 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | 2,2,3,3-tetrafluoro-1-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)propan-1-one |
| SMILES | CC1Cc2cc(C(=O)C(F)(F)C(F)F)ccc2O1 |
| InChI | InChI=1S/C12H10F4O2/c1-6-4-8-5-7(2-3-9(8)18-6)10(17)12(15,16)11(13)14/h2-3,5-6,11H,4H2,1H3 |
| InChIKey | FQAHSPOKZALXAI-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.20 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|