C13H15ClO2 — CID 86161762
4-chloro-1-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)butan-1-one (PubChem CID 86161762) has the molecular formula C13H15ClO2 and a molecular weight of 238.71 g/mol. Its IUPAC name is 4-chloro-1-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)butan-1-one.
| Compound Name | 4-chloro-1-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)butan-1-one |
|---|---|
| PubChem CID | 86161762 |
| Molecular Formula | C13H15ClO2 |
| Molecular Weight | 238.71 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 4-chloro-1-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)butan-1-one |
| SMILES | CC1Cc2cc(C(=O)CCCCl)ccc2O1 |
| InChI | InChI=1S/C13H15ClO2/c1-9-7-11-8-10(4-5-13(11)16-9)12(15)3-2-6-14/h4-5,8-9H,2-3,6-7H2,1H3 |
| InChIKey | TXPJDUSCEZIBEH-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.71 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|