C9H9BF3O- — CID 63677632
trifluoro-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)boranuide (PubChem CID 63677632) has the molecular formula C9H9BF3O- and a molecular weight of 200.98 g/mol. Its IUPAC name is trifluoro-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)boranuide.
| Compound Name | trifluoro-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)boranuide |
|---|---|
| PubChem CID | 63677632 |
| Molecular Formula | C9H9BF3O- |
| Molecular Weight | 200.98 g/mol |
| Exact Mass | 201.07 |
| IUPAC Name | trifluoro-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)boranuide |
| SMILES | CC1Cc2cc([B-](F)(F)F)ccc2O1 |
| InChI | InChI=1S/C9H9BF3O/c1-6-4-7-5-8(10(11,12)13)2-3-9(7)14-6/h2-3,5-6H,4H2,1H3/q-1 |
| InChIKey | LBYMQVMWXFWBHP-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.98 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|