C10H11BrO2 — CID 117200868
1-(5-bromo-2,3-dihydro-1-benzofuran-2-yl)ethanol (PubChem CID 117200868) has the molecular formula C10H11BrO2 and a molecular weight of 243.10 g/mol. Its IUPAC name is 1-(5-bromo-2,3-dihydro-1-benzofuran-2-yl)ethanol.
| Compound Name | 1-(5-bromo-2,3-dihydro-1-benzofuran-2-yl)ethanol |
|---|---|
| PubChem CID | 117200868 |
| Molecular Formula | C10H11BrO2 |
| Molecular Weight | 243.10 g/mol |
| Exact Mass | 241.99 |
| IUPAC Name | 1-(5-bromo-2,3-dihydro-1-benzofuran-2-yl)ethanol |
| SMILES | CC(O)C1Cc2cc(Br)ccc2O1 |
| InChI | InChI=1S/C10H11BrO2/c1-6(12)10-5-7-4-8(11)2-3-9(7)13-10/h2-4,6,10,12H,5H2,1H3 |
| InChIKey | DWVOFRPDEWIPDU-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.10 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |