C13H20O — CID 90989077
(2R,3S)-2,3-dimethyl-3,4-dihydro-2H-chromene;ethane (PubChem CID 90989077) has the molecular formula C13H20O and a molecular weight of 192.30 g/mol. Its IUPAC name is (2R,3S)-2,3-dimethyl-3,4-dihydro-2H-chromene;ethane.
| Compound Name | (2R,3S)-2,3-dimethyl-3,4-dihydro-2H-chromene;ethane |
|---|---|
| PubChem CID | 90989077 |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | (2R,3S)-2,3-dimethyl-3,4-dihydro-2H-chromene;ethane |
| SMILES | CC.C[C@H]1Cc2ccccc2O[C@@H]1C |
| InChI | InChI=1S/C11H14O.C2H6/c1-8-7-10-5-3-4-6-11(10)12-9(8)2;1-2/h3-6,8-9H,7H2,1-2H3;1-2H3/t8-,9+;/m0./s1 |
| InChIKey | BHQMDVWJZBHANO-OULXEKPRSA-N |
| XLogP | 3.67 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |