C19H20O2 — CID 123821193
2,11-dioxatetracyclo[8.8.3.03,8.012,17]henicosa-3,5,7,12,14,16-hexaene (PubChem CID 123821193) has the molecular formula C19H20O2 and a molecular weight of 280.37 g/mol. Its IUPAC name is 2,11-dioxatetracyclo[8.8.3.03,8.012,17]henicosa-3,5,7,12,14,16-hexaene.
| Compound Name | 2,11-dioxatetracyclo[8.8.3.03,8.012,17]henicosa-3,5,7,12,14,16-hexaene |
|---|---|
| PubChem CID | 123821193 |
| Molecular Formula | C19H20O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | 2,11-dioxatetracyclo[8.8.3.03,8.012,17]henicosa-3,5,7,12,14,16-hexaene |
| SMILES | c1ccc2c(c1)CC1CCCC(Cc3ccccc3O1)O2 |
| InChI | InChI=1S/C19H20O2/c1-3-10-18-14(6-1)12-16-8-5-9-17(20-18)13-15-7-2-4-11-19(15)21-16/h1-4,6-7,10-11,16-17H,5,8-9,12-13H2 |
| InChIKey | TZNJTYPAFLKTRR-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |