C13H16O — CID 101459378
(4aS,9aS)-2,3,4,4a,9,9a-hexahydro-1H-xanthene (PubChem CID 101459378) has the molecular formula C13H16O and a molecular weight of 188.27 g/mol. Its IUPAC name is (4aS,9aS)-2,3,4,4a,9,9a-hexahydro-1H-xanthene.
| Compound Name | (4aS,9aS)-2,3,4,4a,9,9a-hexahydro-1H-xanthene |
|---|---|
| PubChem CID | 101459378 |
| Molecular Formula | C13H16O |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | (4aS,9aS)-2,3,4,4a,9,9a-hexahydro-1H-xanthene |
| SMILES | c1ccc2c(c1)C[C@@H]1CCCC[C@@H]1O2 |
| InChI | InChI=1S/C13H16O/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12/h1,3,5,7,11,13H,2,4,6,8-9H2/t11-,13-/m0/s1 |
| InChIKey | NYWZDSOFNYKBME-AAEUAGOBSA-N |
| XLogP | 3.18 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |