C12H14O2 — CID 175976158
2-(oxetan-3-yl)-3,4-dihydro-2H-chromene (PubChem CID 175976158) has the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. Its IUPAC name is 2-(oxetan-3-yl)-3,4-dihydro-2H-chromene.
| Compound Name | 2-(oxetan-3-yl)-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 175976158 |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | 2-(oxetan-3-yl)-3,4-dihydro-2H-chromene |
| SMILES | c1ccc2c(c1)CCC(C1COC1)O2 |
| InChI | InChI=1S/C12H14O2/c1-2-4-11-9(3-1)5-6-12(14-11)10-7-13-8-10/h1-4,10,12H,5-8H2 |
| InChIKey | FNKKOJCODIPFNC-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |