C11H12O2 — CID 102531823
(2R)-2-[(2S)-oxiran-2-yl]-3,4-dihydro-2H-chromene (PubChem CID 102531823) has the molecular formula C11H12O2 and a molecular weight of 176.22 g/mol. Its IUPAC name is (2R)-2-[(2S)-oxiran-2-yl]-3,4-dihydro-2H-chromene.
| Compound Name | (2R)-2-[(2S)-oxiran-2-yl]-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 102531823 |
| Molecular Formula | C11H12O2 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | (2R)-2-[(2S)-oxiran-2-yl]-3,4-dihydro-2H-chromene |
| SMILES | c1ccc2c(c1)CC[C@H]([C@@H]1CO1)O2 |
| InChI | InChI=1S/C11H12O2/c1-2-4-9-8(3-1)5-6-10(13-9)11-7-12-11/h1-4,10-11H,5-7H2/t10-,11+/m1/s1 |
| InChIKey | VECXQFNJFMVRGT-MNOVXSKESA-N |
| XLogP | 1.78 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|