C11H11FO2 — CID 87716136
3-fluoro-2-(oxiran-2-yl)-3,4-dihydro-2H-chromene (PubChem CID 87716136) has the molecular formula C11H11FO2 and a molecular weight of 194.21 g/mol. Its IUPAC name is 3-fluoro-2-(oxiran-2-yl)-3,4-dihydro-2H-chromene.
| Compound Name | 3-fluoro-2-(oxiran-2-yl)-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 87716136 |
| Molecular Formula | C11H11FO2 |
| Molecular Weight | 194.21 g/mol |
| Exact Mass | 194.07 |
| IUPAC Name | 3-fluoro-2-(oxiran-2-yl)-3,4-dihydro-2H-chromene |
| SMILES | FC1Cc2ccccc2OC1C1CO1 |
| InChI | InChI=1S/C11H11FO2/c12-8-5-7-3-1-2-4-9(7)14-11(8)10-6-13-10/h1-4,8,10-11H,5-6H2 |
| InChIKey | JFRNWHXRLXTDJI-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.21 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|