About 4-(2,3-dihydro-1-benzofuran-2-ylmethyl)morpholine-2,6-dione
4-(2,3-dihydro-1-benzofuran-2-ylmethyl)morpholine-2,6-dione (PubChem CID 63777403) has the molecular formula C13H13NO4
and a molecular weight of 247.25 g/mol. Its IUPAC name is 4-(2,3-dihydro-1-benzofuran-2-ylmethyl)morpholine-2,6-dione.
Molecular Properties
| Compound Name | 4-(2,3-dihydro-1-benzofuran-2-ylmethyl)morpholine-2,6-dione |
| PubChem CID | 63777403 |
| Molecular Formula | C13H13NO4 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | 4-(2,3-dihydro-1-benzofuran-2-ylmethyl)morpholine-2,6-dione |
| SMILES | O=C1CN(CC2Cc3ccccc3O2)CC(=O)O1 |
| InChI | InChI=1S/C13H13NO4/c15-12-7-14(8-13(16)18-12)6-10-5-9-3-1-2-4-11(9)17-10/h1-4,10H,5-8H2 |
| InChIKey | VJZHIBRFRVXJFQ-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,3-dihydro-1-benzofuran-2-ylmethyl)morpholine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,3-dihydro-1-benzofuran-2-ylmethyl)morpholine-2,6-dione?
The IUPAC name of 4-(2,3-dihydro-1-benzofuran-2-ylmethyl)morpholine-2,6-dione (CID 63777403) is 4-(2,3-dihydro-1-benzofuran-2-ylmethyl)morpholine-2,6-dione.
What is the SMILES notation for 4-(2,3-dihydro-1-benzofuran-2-ylmethyl)morpholine-2,6-dione?
The canonical SMILES for 4-(2,3-dihydro-1-benzofuran-2-ylmethyl)morpholine-2,6-dione is O=C1CN(CC2Cc3ccccc3O2)CC(=O)O1.
What is the InChIKey of 4-(2,3-dihydro-1-benzofuran-2-ylmethyl)morpholine-2,6-dione?
The InChIKey is VJZHIBRFRVXJFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO4/c15-12-7-14(8-13(16)18-12)6-10-5-9-3-1-2-4-11(9)17-10/h1-4,10H,5-8H2.
What are the key properties of 4-(2,3-dihydro-1-benzofuran-2-ylmethyl)morpholine-2,6-dione?
4-(2,3-dihydro-1-benzofuran-2-ylmethyl)morpholine-2,6-dione has a molecular weight of 247.25 g/mol, XLogP of 0.38, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,3-dihydro-1-benzofuran-2-ylmethyl)morpholine-2,6-dione is sourced from PubChem (CID 63777403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).