C18H20N2O — CID 114524219
2-(2,3-dihydro-1-benzofuran-2-ylmethyl)-3,4-dihydro-1H-isoquinolin-8-amine (PubChem CID 114524219) has the molecular formula C18H20N2O and a molecular weight of 280.37 g/mol. Its IUPAC name is 2-(2,3-dihydro-1-benzofuran-2-ylmethyl)-3,4-dihydro-1H-isoquinolin-8-amine.
| Compound Name | 2-(2,3-dihydro-1-benzofuran-2-ylmethyl)-3,4-dihydro-1H-isoquinolin-8-amine |
|---|---|
| PubChem CID | 114524219 |
| Molecular Formula | C18H20N2O |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 2-(2,3-dihydro-1-benzofuran-2-ylmethyl)-3,4-dihydro-1H-isoquinolin-8-amine |
| SMILES | Nc1cccc2c1CN(CC1Cc3ccccc3O1)CC2 |
| InChI | InChI=1S/C18H20N2O/c19-17-6-3-5-13-8-9-20(12-16(13)17)11-15-10-14-4-1-2-7-18(14)21-15/h1-7,15H,8-12,19H2 |
| InChIKey | ZMEIPMPCKFIJMF-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|