C11H17N3 — CID 82581881
2-(2-aminoethyl)-3,4-dihydro-1H-isoquinolin-8-amine (PubChem CID 82581881) has the molecular formula C11H17N3 and a molecular weight of 191.28 g/mol. Its IUPAC name is 2-(2-aminoethyl)-3,4-dihydro-1H-isoquinolin-8-amine.
| Compound Name | 2-(2-aminoethyl)-3,4-dihydro-1H-isoquinolin-8-amine |
|---|---|
| PubChem CID | 82581881 |
| Molecular Formula | C11H17N3 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | 2-(2-aminoethyl)-3,4-dihydro-1H-isoquinolin-8-amine |
| SMILES | NCCN1CCc2cccc(N)c2C1 |
| InChI | InChI=1S/C11H17N3/c12-5-7-14-6-4-9-2-1-3-11(13)10(9)8-14/h1-3H,4-8,12-13H2 |
| InChIKey | FVIDYIBIMHYQMX-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|