About 2-(2-fluoroethyl)-3,4-dihydro-1H-isoquinolin-5-amine
2-(2-fluoroethyl)-3,4-dihydro-1H-isoquinolin-5-amine (PubChem CID 80695773) has the molecular formula C11H15FN2
and a molecular weight of 194.25 g/mol. Its IUPAC name is 2-(2-fluoroethyl)-3,4-dihydro-1H-isoquinolin-5-amine.
Molecular Properties
| Compound Name | 2-(2-fluoroethyl)-3,4-dihydro-1H-isoquinolin-5-amine |
| PubChem CID | 80695773 |
| Molecular Formula | C11H15FN2 |
| Molecular Weight | 194.25 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | 2-(2-fluoroethyl)-3,4-dihydro-1H-isoquinolin-5-amine |
| SMILES | Nc1cccc2c1CCN(CCF)C2 |
| InChI | InChI=1S/C11H15FN2/c12-5-7-14-6-4-10-9(8-14)2-1-3-11(10)13/h1-3H,4-8,13H2 |
| InChIKey | TYKIMTGGNJLCJT-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.25 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-fluoroethyl)-3,4-dihydro-1H-isoquinolin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-fluoroethyl)-3,4-dihydro-1H-isoquinolin-5-amine?
The IUPAC name of 2-(2-fluoroethyl)-3,4-dihydro-1H-isoquinolin-5-amine (CID 80695773) is 2-(2-fluoroethyl)-3,4-dihydro-1H-isoquinolin-5-amine.
What is the SMILES notation for 2-(2-fluoroethyl)-3,4-dihydro-1H-isoquinolin-5-amine?
The canonical SMILES for 2-(2-fluoroethyl)-3,4-dihydro-1H-isoquinolin-5-amine is Nc1cccc2c1CCN(CCF)C2.
What is the InChIKey of 2-(2-fluoroethyl)-3,4-dihydro-1H-isoquinolin-5-amine?
The InChIKey is TYKIMTGGNJLCJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15FN2/c12-5-7-14-6-4-10-9(8-14)2-1-3-11(10)13/h1-3H,4-8,13H2.
What are the key properties of 2-(2-fluoroethyl)-3,4-dihydro-1H-isoquinolin-5-amine?
2-(2-fluoroethyl)-3,4-dihydro-1H-isoquinolin-5-amine has a molecular weight of 194.25 g/mol, XLogP of 1.60, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-fluoroethyl)-3,4-dihydro-1H-isoquinolin-5-amine is sourced from PubChem (CID 80695773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).