C11H15FN2 — CID 80695773
2-(2-fluoroethyl)-3,4-dihydro-1H-isoquinolin-5-amine (PubChem CID 80695773) has the molecular formula C11H15FN2 and a molecular weight of 194.25 g/mol. Its IUPAC name is 2-(2-fluoroethyl)-3,4-dihydro-1H-isoquinolin-5-amine.
| Compound Name | 2-(2-fluoroethyl)-3,4-dihydro-1H-isoquinolin-5-amine |
|---|---|
| PubChem CID | 80695773 |
| Molecular Formula | C11H15FN2 |
| Molecular Weight | 194.25 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | 2-(2-fluoroethyl)-3,4-dihydro-1H-isoquinolin-5-amine |
| SMILES | Nc1cccc2c1CCN(CCF)C2 |
| InChI | InChI=1S/C11H15FN2/c12-5-7-14-6-4-10-9(8-14)2-1-3-11(10)13/h1-3H,4-8,13H2 |
| InChIKey | TYKIMTGGNJLCJT-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.25 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|