C10H12N2O — CID 143544356
5-amino-3,4-dihydro-1H-isoquinoline-2-carbaldehyde (PubChem CID 143544356) has the molecular formula C10H12N2O and a molecular weight of 176.22 g/mol. Its IUPAC name is 5-amino-3,4-dihydro-1H-isoquinoline-2-carbaldehyde.
| Compound Name | 5-amino-3,4-dihydro-1H-isoquinoline-2-carbaldehyde |
|---|---|
| PubChem CID | 143544356 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | 5-amino-3,4-dihydro-1H-isoquinoline-2-carbaldehyde |
| SMILES | Nc1cccc2c1CCN(C=O)C2 |
| InChI | InChI=1S/C10H12N2O/c11-10-3-1-2-8-6-12(7-13)5-4-9(8)10/h1-3,7H,4-6,11H2 |
| InChIKey | YWIXXTXGWNYICA-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|