C14H20N2 — CID 103563697
2-(3-methylcyclobutyl)-3,4-dihydro-1H-isoquinolin-5-amine (PubChem CID 103563697) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is 2-(3-methylcyclobutyl)-3,4-dihydro-1H-isoquinolin-5-amine.
| Compound Name | 2-(3-methylcyclobutyl)-3,4-dihydro-1H-isoquinolin-5-amine |
|---|---|
| PubChem CID | 103563697 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | 2-(3-methylcyclobutyl)-3,4-dihydro-1H-isoquinolin-5-amine |
| SMILES | CC1CC(N2CCc3c(N)cccc3C2)C1 |
| InChI | InChI=1S/C14H20N2/c1-10-7-12(8-10)16-6-5-13-11(9-16)3-2-4-14(13)15/h2-4,10,12H,5-9,15H2,1H3 |
| InChIKey | CAXSZKJWKLIBSZ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|