C17H27N3 — CID 114522276
2-(1-ethylazepan-4-yl)-3,4-dihydro-1H-isoquinolin-8-amine (PubChem CID 114522276) has the molecular formula C17H27N3 and a molecular weight of 273.42 g/mol. Its IUPAC name is 2-(1-ethylazepan-4-yl)-3,4-dihydro-1H-isoquinolin-8-amine.
| Compound Name | 2-(1-ethylazepan-4-yl)-3,4-dihydro-1H-isoquinolin-8-amine |
|---|---|
| PubChem CID | 114522276 |
| Molecular Formula | C17H27N3 |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.22 |
| IUPAC Name | 2-(1-ethylazepan-4-yl)-3,4-dihydro-1H-isoquinolin-8-amine |
| SMILES | CCN1CCCC(N2CCc3cccc(N)c3C2)CC1 |
| InChI | InChI=1S/C17H27N3/c1-2-19-10-4-6-15(9-11-19)20-12-8-14-5-3-7-17(18)16(14)13-20/h3,5,7,15H,2,4,6,8-13,18H2,1H3 |
| InChIKey | VUVBMMZQRAUULU-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|