C15H22N2S — CID 114522069
2-(2-methylthian-3-yl)-3,4-dihydro-1H-isoquinolin-8-amine (PubChem CID 114522069) has the molecular formula C15H22N2S and a molecular weight of 262.42 g/mol. Its IUPAC name is 2-(2-methylthian-3-yl)-3,4-dihydro-1H-isoquinolin-8-amine.
| Compound Name | 2-(2-methylthian-3-yl)-3,4-dihydro-1H-isoquinolin-8-amine |
|---|---|
| PubChem CID | 114522069 |
| Molecular Formula | C15H22N2S |
| Molecular Weight | 262.42 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | 2-(2-methylthian-3-yl)-3,4-dihydro-1H-isoquinolin-8-amine |
| SMILES | CC1SCCCC1N1CCc2cccc(N)c2C1 |
| InChI | InChI=1S/C15H22N2S/c1-11-15(6-3-9-18-11)17-8-7-12-4-2-5-14(16)13(12)10-17/h2,4-5,11,15H,3,6-10,16H2,1H3 |
| InChIKey | BIUVVUNWMBGPSN-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.42 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|