C19H30N2 — CID 107429453
2-[3-(2-methylpropyl)cyclohexyl]-3,4-dihydro-1H-isoquinolin-8-amine (PubChem CID 107429453) has the molecular formula C19H30N2 and a molecular weight of 286.46 g/mol. Its IUPAC name is 2-[3-(2-methylpropyl)cyclohexyl]-3,4-dihydro-1H-isoquinolin-8-amine.
| Compound Name | 2-[3-(2-methylpropyl)cyclohexyl]-3,4-dihydro-1H-isoquinolin-8-amine |
|---|---|
| PubChem CID | 107429453 |
| Molecular Formula | C19H30N2 |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.24 |
| IUPAC Name | 2-[3-(2-methylpropyl)cyclohexyl]-3,4-dihydro-1H-isoquinolin-8-amine |
| SMILES | CC(C)CC1CCCC(N2CCc3cccc(N)c3C2)C1 |
| InChI | InChI=1S/C19H30N2/c1-14(2)11-15-5-3-7-17(12-15)21-10-9-16-6-4-8-19(20)18(16)13-21/h4,6,8,14-15,17H,3,5,7,9-13,20H2,1-2H3 |
| InChIKey | RQMCRBKKMCJFQT-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|