C14H20N2O2S — CID 114522543
2-(1,1-dioxothian-4-yl)-3,4-dihydro-1H-isoquinolin-8-amine (PubChem CID 114522543) has the molecular formula C14H20N2O2S and a molecular weight of 280.39 g/mol. Its IUPAC name is 2-(1,1-dioxothian-4-yl)-3,4-dihydro-1H-isoquinolin-8-amine.
| Compound Name | 2-(1,1-dioxothian-4-yl)-3,4-dihydro-1H-isoquinolin-8-amine |
|---|---|
| PubChem CID | 114522543 |
| Molecular Formula | C14H20N2O2S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 2-(1,1-dioxothian-4-yl)-3,4-dihydro-1H-isoquinolin-8-amine |
| SMILES | Nc1cccc2c1CN(C1CCS(=O)(=O)CC1)CC2 |
| InChI | InChI=1S/C14H20N2O2S/c15-14-3-1-2-11-4-7-16(10-13(11)14)12-5-8-19(17,18)9-6-12/h1-3,12H,4-10,15H2 |
| InChIKey | KYRWVJRQMXCBAO-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|