C14H19N3O2 — CID 79152246
(5-amino-3,4-dihydro-1H-isoquinolin-2-yl)-morpholin-4-ylmethanone (PubChem CID 79152246) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is (5-amino-3,4-dihydro-1H-isoquinolin-2-yl)-morpholin-4-ylmethanone.
| Compound Name | (5-amino-3,4-dihydro-1H-isoquinolin-2-yl)-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 79152246 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | (5-amino-3,4-dihydro-1H-isoquinolin-2-yl)-morpholin-4-ylmethanone |
| SMILES | Nc1cccc2c1CCN(C(=O)N1CCOCC1)C2 |
| InChI | InChI=1S/C14H19N3O2/c15-13-3-1-2-11-10-17(5-4-12(11)13)14(18)16-6-8-19-9-7-16/h1-3H,4-10,15H2 |
| InChIKey | NJGWXOOZUTWMLW-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|