C16H19N3O2 — CID 110874353
morpholin-4-yl(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)methanone (PubChem CID 110874353) has the molecular formula C16H19N3O2 and a molecular weight of 285.35 g/mol. Its IUPAC name is morpholin-4-yl(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)methanone.
| Compound Name | morpholin-4-yl(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)methanone |
|---|---|
| PubChem CID | 110874353 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | morpholin-4-yl(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)methanone |
| SMILES | O=C(N1CCOCC1)N1CCc2c([nH]c3ccccc23)C1 |
| InChI | InChI=1S/C16H19N3O2/c20-16(18-7-9-21-10-8-18)19-6-5-13-12-3-1-2-4-14(12)17-15(13)11-19/h1-4,17H,5-11H2 |
| InChIKey | KNRNYLMTKZGLCH-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 48.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|