C11H10N2O2 — CID 175852377
3,4-dihydro-1H-pyrrolo[3,4-b]indole-2-carboxylic acid (PubChem CID 175852377) has the molecular formula C11H10N2O2 and a molecular weight of 202.21 g/mol. Its IUPAC name is 3,4-dihydro-1H-pyrrolo[3,4-b]indole-2-carboxylic acid.
| Compound Name | 3,4-dihydro-1H-pyrrolo[3,4-b]indole-2-carboxylic acid |
|---|---|
| PubChem CID | 175852377 |
| Molecular Formula | C11H10N2O2 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | 3,4-dihydro-1H-pyrrolo[3,4-b]indole-2-carboxylic acid |
| SMILES | O=C(O)N1Cc2[nH]c3ccccc3c2C1 |
| InChI | InChI=1S/C11H10N2O2/c14-11(15)13-5-8-7-3-1-2-4-9(7)12-10(8)6-13/h1-4,12H,5-6H2,(H,14,15) |
| InChIKey | KFLTXJSLPCHQFX-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|