C19H19N3O — CID 23113540
N-phenyl-3,4,5,10-tetrahydro-1H-azepino[3,4-b]indole-2-carboxamide (PubChem CID 23113540) has the molecular formula C19H19N3O and a molecular weight of 305.38 g/mol. Its IUPAC name is N-phenyl-3,4,5,10-tetrahydro-1H-azepino[3,4-b]indole-2-carboxamide.
| Compound Name | N-phenyl-3,4,5,10-tetrahydro-1H-azepino[3,4-b]indole-2-carboxamide |
|---|---|
| PubChem CID | 23113540 |
| Molecular Formula | C19H19N3O |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | N-phenyl-3,4,5,10-tetrahydro-1H-azepino[3,4-b]indole-2-carboxamide |
| SMILES | O=C(Nc1ccccc1)N1CCCc2c([nH]c3ccccc23)C1 |
| InChI | InChI=1S/C19H19N3O/c23-19(20-14-7-2-1-3-8-14)22-12-6-10-16-15-9-4-5-11-17(15)21-18(16)13-22/h1-5,7-9,11,21H,6,10,12-13H2,(H,20,23) |
| InChIKey | VBPAKPBYEBXBIV-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|