C20H20N4O3 — CID 42506966
N-[2-(3-hydroxyanilino)-2-oxoethyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide (PubChem CID 42506966) has the molecular formula C20H20N4O3 and a molecular weight of 364.41 g/mol. Its IUPAC name is N-[2-(3-hydroxyanilino)-2-oxoethyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide.
| Compound Name | N-[2-(3-hydroxyanilino)-2-oxoethyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide |
|---|---|
| PubChem CID | 42506966 |
| Molecular Formula | C20H20N4O3 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | N-[2-(3-hydroxyanilino)-2-oxoethyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide |
| SMILES | O=C(CNC(=O)N1CCc2c([nH]c3ccccc23)C1)Nc1cccc(O)c1 |
| InChI | InChI=1S/C20H20N4O3/c25-14-5-3-4-13(10-14)22-19(26)11-21-20(27)24-9-8-16-15-6-1-2-7-17(15)23-18(16)12-24/h1-7,10,23,25H,8-9,11-12H2,(H,21,27)(H,22,26) |
| InChIKey | NBRPHDHLLJQFQQ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|