C18H22N4O4S — CID 42506552
N-[2-[[(3R)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide (PubChem CID 42506552) has the molecular formula C18H22N4O4S and a molecular weight of 390.47 g/mol. Its IUPAC name is N-[2-[[(3R)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide.
| Compound Name | N-[2-[[(3R)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide |
|---|---|
| PubChem CID | 42506552 |
| Molecular Formula | C18H22N4O4S |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | N-[2-[[(3R)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide |
| SMILES | O=C(CNC(=O)N1CCc2c([nH]c3ccccc23)C1)N[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H22N4O4S/c23-17(20-12-6-8-27(25,26)11-12)9-19-18(24)22-7-5-14-13-3-1-2-4-15(13)21-16(14)10-22/h1-4,12,21H,5-11H2,(H,19,24)(H,20,23)/t12-/m1/s1 |
| InChIKey | AAKSDVYBQGRKBH-GFCCVEGCSA-N |
| XLogP | 0.54 |
| TPSA | 111.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|