C15H20N2O5S — CID 94811329
N-[(3R)-1,1-dioxothiolan-3-yl]-2-[(2-phenylmethoxyacetyl)amino]acetamide (PubChem CID 94811329) has the molecular formula C15H20N2O5S and a molecular weight of 340.40 g/mol. Its IUPAC name is N-[(3R)-1,1-dioxothiolan-3-yl]-2-[(2-phenylmethoxyacetyl)amino]acetamide.
| Compound Name | N-[(3R)-1,1-dioxothiolan-3-yl]-2-[(2-phenylmethoxyacetyl)amino]acetamide |
|---|---|
| PubChem CID | 94811329 |
| Molecular Formula | C15H20N2O5S |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | N-[(3R)-1,1-dioxothiolan-3-yl]-2-[(2-phenylmethoxyacetyl)amino]acetamide |
| SMILES | O=C(COCc1ccccc1)NCC(=O)N[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H20N2O5S/c18-14(17-13-6-7-23(20,21)11-13)8-16-15(19)10-22-9-12-4-2-1-3-5-12/h1-5,13H,6-11H2,(H,16,19)(H,17,18)/t13-/m1/s1 |
| InChIKey | XSZICUJNFJHKKT-CYBMUJFWSA-N |
| XLogP | -0.38 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |