C13H17NO3S2 — CID 4026635
2-benzylsulfanyl-N-(1,1-dioxothiolan-3-yl)acetamide (PubChem CID 4026635) has the molecular formula C13H17NO3S2 and a molecular weight of 299.42 g/mol. Its IUPAC name is 2-benzylsulfanyl-N-(1,1-dioxothiolan-3-yl)acetamide.
| Compound Name | 2-benzylsulfanyl-N-(1,1-dioxothiolan-3-yl)acetamide |
|---|---|
| PubChem CID | 4026635 |
| Molecular Formula | C13H17NO3S2 |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | 2-benzylsulfanyl-N-(1,1-dioxothiolan-3-yl)acetamide |
| SMILES | O=C(CSCc1ccccc1)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H17NO3S2/c15-13(14-12-6-7-19(16,17)10-12)9-18-8-11-4-2-1-3-5-11/h1-5,12H,6-10H2,(H,14,15) |
| InChIKey | TXJZXVHRPKKTNM-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |