C12H16N2O3S — CID 3805798
N'-(1,1-dioxothiolan-3-yl)-2-phenylacetohydrazide (PubChem CID 3805798) has the molecular formula C12H16N2O3S and a molecular weight of 268.34 g/mol. Its IUPAC name is N'-(1,1-dioxothiolan-3-yl)-2-phenylacetohydrazide.
| Compound Name | N'-(1,1-dioxothiolan-3-yl)-2-phenylacetohydrazide |
|---|---|
| PubChem CID | 3805798 |
| Molecular Formula | C12H16N2O3S |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | N'-(1,1-dioxothiolan-3-yl)-2-phenylacetohydrazide |
| SMILES | O=C(Cc1ccccc1)NNC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H16N2O3S/c15-12(8-10-4-2-1-3-5-10)14-13-11-6-7-18(16,17)9-11/h1-5,11,13H,6-9H2,(H,14,15) |
| InChIKey | WMPYHOGRYGUFPW-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|