C19H28N2O3S — CID 109026321
3-(4-benzylpiperidin-1-yl)-N-(1,1-dioxothiolan-3-yl)propanamide (PubChem CID 109026321) has the molecular formula C19H28N2O3S and a molecular weight of 364.51 g/mol. Its IUPAC name is 3-(4-benzylpiperidin-1-yl)-N-(1,1-dioxothiolan-3-yl)propanamide.
| Compound Name | 3-(4-benzylpiperidin-1-yl)-N-(1,1-dioxothiolan-3-yl)propanamide |
|---|---|
| PubChem CID | 109026321 |
| Molecular Formula | C19H28N2O3S |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 3-(4-benzylpiperidin-1-yl)-N-(1,1-dioxothiolan-3-yl)propanamide |
| SMILES | O=C(CCN1CCC(Cc2ccccc2)CC1)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C19H28N2O3S/c22-19(20-18-9-13-25(23,24)15-18)8-12-21-10-6-17(7-11-21)14-16-4-2-1-3-5-16/h1-5,17-18H,6-15H2,(H,20,22) |
| InChIKey | KPXPNISQJLNBHE-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |