C21H32N4O3S — CID 111152934
3-[[C-(4-benzylpiperidin-1-yl)-N-methylcarbonimidoyl]amino]-N-(1,1-dioxothiolan-3-yl)propanamide (PubChem CID 111152934) has the molecular formula C21H32N4O3S and a molecular weight of 420.58 g/mol. Its IUPAC name is 3-[[C-(4-benzylpiperidin-1-yl)-N-methylcarbonimidoyl]amino]-N-(1,1-dioxothiolan-3-yl)propanamide.
| Compound Name | 3-[[C-(4-benzylpiperidin-1-yl)-N-methylcarbonimidoyl]amino]-N-(1,1-dioxothiolan-3-yl)propanamide |
|---|---|
| PubChem CID | 111152934 |
| Molecular Formula | C21H32N4O3S |
| Molecular Weight | 420.58 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | 3-[[C-(4-benzylpiperidin-1-yl)-N-methylcarbonimidoyl]amino]-N-(1,1-dioxothiolan-3-yl)propanamide |
| SMILES | C/N=C(\NCCC(=O)NC1CCS(=O)(=O)C1)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C21H32N4O3S/c1-22-21(23-11-7-20(26)24-19-10-14-29(27,28)16-19)25-12-8-18(9-13-25)15-17-5-3-2-4-6-17/h2-6,18-19H,7-16H2,1H3,(H,22,23)(H,24,26) |
| InChIKey | QZFHVGTZWVUSMK-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.58 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|