C17H31IN4O3S — CID 109443558
3-[[C-(1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-N-methylcarbonimidoyl]amino]-N-(1,1-dioxothiolan-3-yl)propanamide;hydroiodide (PubChem CID 109443558) has the molecular formula C17H31IN4O3S and a molecular weight of 498.43 g/mol. Its IUPAC name is 3-[[C-(1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-N-methylcarbonimidoyl]amino]-N-(1,1-dioxothiolan-3-yl)propanamide;hydroiodide.
| Compound Name | 3-[[C-(1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-N-methylcarbonimidoyl]amino]-N-(1,1-dioxothiolan-3-yl)propanamide;hydroiodide |
|---|---|
| PubChem CID | 109443558 |
| Molecular Formula | C17H31IN4O3S |
| Molecular Weight | 498.43 g/mol |
| Exact Mass | 498.12 |
| IUPAC Name | 3-[[C-(1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-N-methylcarbonimidoyl]amino]-N-(1,1-dioxothiolan-3-yl)propanamide;hydroiodide |
| SMILES | C/N=C(\NCCC(=O)NC1CCS(=O)(=O)C1)N1CC2CCCCC2C1.I |
| InChI | InChI=1S/C17H30N4O3S.HI/c1-18-17(21-10-13-4-2-3-5-14(13)11-21)19-8-6-16(22)20-15-7-9-25(23,24)12-15;/h13-15H,2-12H2,1H3,(H,18,19)(H,20,22);1H |
| InChIKey | QSNJNFDDUFLTBG-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.43 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|