C18H28N6O3S — CID 111219245
N-(1,1-dioxothiolan-3-yl)-3-[[N-methyl-C-(4-pyridin-2-ylpiperazin-1-yl)carbonimidoyl]amino]propanamide (PubChem CID 111219245) has the molecular formula C18H28N6O3S and a molecular weight of 408.53 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-3-[[N-methyl-C-(4-pyridin-2-ylpiperazin-1-yl)carbonimidoyl]amino]propanamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-3-[[N-methyl-C-(4-pyridin-2-ylpiperazin-1-yl)carbonimidoyl]amino]propanamide |
|---|---|
| PubChem CID | 111219245 |
| Molecular Formula | C18H28N6O3S |
| Molecular Weight | 408.53 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-3-[[N-methyl-C-(4-pyridin-2-ylpiperazin-1-yl)carbonimidoyl]amino]propanamide |
| SMILES | C/N=C(\NCCC(=O)NC1CCS(=O)(=O)C1)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C18H28N6O3S/c1-19-18(21-8-5-17(25)22-15-6-13-28(26,27)14-15)24-11-9-23(10-12-24)16-4-2-3-7-20-16/h2-4,7,15H,5-6,8-14H2,1H3,(H,19,21)(H,22,25) |
| InChIKey | IWQWEPMFBFMORP-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 107.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.53 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|