C17H27N5O2S — CID 111220795
N'-[(1,1-dioxothiolan-3-yl)methyl]-N-ethyl-4-pyridin-2-ylpiperazine-1-carboximidamide (PubChem CID 111220795) has the molecular formula C17H27N5O2S and a molecular weight of 365.50 g/mol. Its IUPAC name is N'-[(1,1-dioxothiolan-3-yl)methyl]-N-ethyl-4-pyridin-2-ylpiperazine-1-carboximidamide.
| Compound Name | N'-[(1,1-dioxothiolan-3-yl)methyl]-N-ethyl-4-pyridin-2-ylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111220795 |
| Molecular Formula | C17H27N5O2S |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | N'-[(1,1-dioxothiolan-3-yl)methyl]-N-ethyl-4-pyridin-2-ylpiperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CC1CCS(=O)(=O)C1)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C17H27N5O2S/c1-2-18-17(20-13-15-6-12-25(23,24)14-15)22-10-8-21(9-11-22)16-5-3-4-7-19-16/h3-5,7,15H,2,6,8-14H2,1H3,(H,18,20) |
| InChIKey | GLBJSBVKPJBCBJ-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 77.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|