C16H33IN4O4S — CID 111971069
N-(1,1-dioxothiolan-3-yl)-3-[[N'-methyl-N-[2-(3-methylbutoxy)ethyl]carbamimidoyl]amino]propanamide;hydroiodide (PubChem CID 111971069) has the molecular formula C16H33IN4O4S and a molecular weight of 504.44 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-3-[[N'-methyl-N-[2-(3-methylbutoxy)ethyl]carbamimidoyl]amino]propanamide;hydroiodide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-3-[[N'-methyl-N-[2-(3-methylbutoxy)ethyl]carbamimidoyl]amino]propanamide;hydroiodide |
|---|---|
| PubChem CID | 111971069 |
| Molecular Formula | C16H33IN4O4S |
| Molecular Weight | 504.44 g/mol |
| Exact Mass | 504.13 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-3-[[N'-methyl-N-[2-(3-methylbutoxy)ethyl]carbamimidoyl]amino]propanamide;hydroiodide |
| SMILES | C/N=C(\NCCOCCC(C)C)NCCC(=O)NC1CCS(=O)(=O)C1.I |
| InChI | InChI=1S/C16H32N4O4S.HI/c1-13(2)5-9-24-10-8-19-16(17-3)18-7-4-15(21)20-14-6-11-25(22,23)12-14;/h13-14H,4-12H2,1-3H3,(H,20,21)(H2,17,18,19);1H |
| InChIKey | YRHNDISGFRYBMC-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 108.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.44 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|