C16H33IN4O3S — CID 111203293
N-(1,1-dioxothiolan-3-yl)-3-[[N'-methyl-N-(5-methylhexan-2-yl)carbamimidoyl]amino]propanamide;hydroiodide (PubChem CID 111203293) has the molecular formula C16H33IN4O3S and a molecular weight of 488.44 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-3-[[N'-methyl-N-(5-methylhexan-2-yl)carbamimidoyl]amino]propanamide;hydroiodide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-3-[[N'-methyl-N-(5-methylhexan-2-yl)carbamimidoyl]amino]propanamide;hydroiodide |
|---|---|
| PubChem CID | 111203293 |
| Molecular Formula | C16H33IN4O3S |
| Molecular Weight | 488.44 g/mol |
| Exact Mass | 488.13 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-3-[[N'-methyl-N-(5-methylhexan-2-yl)carbamimidoyl]amino]propanamide;hydroiodide |
| SMILES | C/N=C(/NCCC(=O)NC1CCS(=O)(=O)C1)NC(C)CCC(C)C.I |
| InChI | InChI=1S/C16H32N4O3S.HI/c1-12(2)5-6-13(3)19-16(17-4)18-9-7-15(21)20-14-8-10-24(22,23)11-14;/h12-14H,5-11H2,1-4H3,(H,20,21)(H2,17,18,19);1H |
| InChIKey | OXHMGMCYOOMCRA-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.44 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|