C18H37N5O3S — CID 110998545
3-[[N-[5-(diethylamino)pentan-2-yl]-N'-methylcarbamimidoyl]amino]-N-(1,1-dioxothiolan-3-yl)propanamide (PubChem CID 110998545) has the molecular formula C18H37N5O3S and a molecular weight of 403.59 g/mol. Its IUPAC name is 3-[[N-[5-(diethylamino)pentan-2-yl]-N'-methylcarbamimidoyl]amino]-N-(1,1-dioxothiolan-3-yl)propanamide.
| Compound Name | 3-[[N-[5-(diethylamino)pentan-2-yl]-N'-methylcarbamimidoyl]amino]-N-(1,1-dioxothiolan-3-yl)propanamide |
|---|---|
| PubChem CID | 110998545 |
| Molecular Formula | C18H37N5O3S |
| Molecular Weight | 403.59 g/mol |
| Exact Mass | 403.26 |
| IUPAC Name | 3-[[N-[5-(diethylamino)pentan-2-yl]-N'-methylcarbamimidoyl]amino]-N-(1,1-dioxothiolan-3-yl)propanamide |
| SMILES | CCN(CC)CCCC(C)N/C(=N\C)NCCC(=O)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H37N5O3S/c1-5-23(6-2)12-7-8-15(3)21-18(19-4)20-11-9-17(24)22-16-10-13-27(25,26)14-16/h15-16H,5-14H2,1-4H3,(H,22,24)(H2,19,20,21) |
| InChIKey | CJOSLLOHFDTHOE-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.59 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|