C17H38IN5O2S — CID 110999736
1-[5-(diethylamino)pentan-2-yl]-3-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-2-methylguanidine;hydroiodide (PubChem CID 110999736) has the molecular formula C17H38IN5O2S and a molecular weight of 503.50 g/mol. Its IUPAC name is 1-[5-(diethylamino)pentan-2-yl]-3-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[5-(diethylamino)pentan-2-yl]-3-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110999736 |
| Molecular Formula | C17H38IN5O2S |
| Molecular Weight | 503.50 g/mol |
| Exact Mass | 503.18 |
| IUPAC Name | 1-[5-(diethylamino)pentan-2-yl]-3-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-2-methylguanidine;hydroiodide |
| SMILES | CCN(CC)CCCC(C)N/C(=N\C)NCCN1CCS(=O)(=O)CC1.I |
| InChI | InChI=1S/C17H37N5O2S.HI/c1-5-21(6-2)10-7-8-16(3)20-17(18-4)19-9-11-22-12-14-25(23,24)15-13-22;/h16H,5-15H2,1-4H3,(H2,18,19,20);1H |
| InChIKey | DUOHLNMMBZUODA-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.50 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|