C19H42IN5 — CID 110998052
1-[2-(azepan-1-yl)ethyl]-3-[5-(diethylamino)pentan-2-yl]-2-methylguanidine;hydroiodide (PubChem CID 110998052) has the molecular formula C19H42IN5 and a molecular weight of 467.48 g/mol. Its IUPAC name is 1-[2-(azepan-1-yl)ethyl]-3-[5-(diethylamino)pentan-2-yl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(azepan-1-yl)ethyl]-3-[5-(diethylamino)pentan-2-yl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110998052 |
| Molecular Formula | C19H42IN5 |
| Molecular Weight | 467.48 g/mol |
| Exact Mass | 467.25 |
| IUPAC Name | 1-[2-(azepan-1-yl)ethyl]-3-[5-(diethylamino)pentan-2-yl]-2-methylguanidine;hydroiodide |
| SMILES | CCN(CC)CCCC(C)N/C(=N\C)NCCN1CCCCCC1.I |
| InChI | InChI=1S/C19H41N5.HI/c1-5-23(6-2)16-11-12-18(3)22-19(20-4)21-13-17-24-14-9-7-8-10-15-24;/h18H,5-17H2,1-4H3,(H2,20,21,22);1H |
| InChIKey | VRYXHXIOZFXMHK-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 42.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.48 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|