C16H36IN5O2S — CID 111247052
1-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-3-[2-[di(propan-2-yl)amino]ethyl]-2-methylguanidine;hydroiodide (PubChem CID 111247052) has the molecular formula C16H36IN5O2S and a molecular weight of 489.47 g/mol. Its IUPAC name is 1-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-3-[2-[di(propan-2-yl)amino]ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-3-[2-[di(propan-2-yl)amino]ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111247052 |
| Molecular Formula | C16H36IN5O2S |
| Molecular Weight | 489.47 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | 1-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-3-[2-[di(propan-2-yl)amino]ethyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCCN1CCS(=O)(=O)CC1)NCCN(C(C)C)C(C)C.I |
| InChI | InChI=1S/C16H35N5O2S.HI/c1-14(2)21(15(3)4)9-7-19-16(17-5)18-6-8-20-10-12-24(22,23)13-11-20;/h14-15H,6-13H2,1-5H3,(H2,17,18,19);1H |
| InChIKey | OPQMDEHHSGVVOJ-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.47 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|