C15H30N6O2 — CID 111829512
1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-3-[2-[di(propan-2-yl)amino]ethyl]-2-methylguanidine (PubChem CID 111829512) has the molecular formula C15H30N6O2 and a molecular weight of 326.45 g/mol. Its IUPAC name is 1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-3-[2-[di(propan-2-yl)amino]ethyl]-2-methylguanidine.
| Compound Name | 1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-3-[2-[di(propan-2-yl)amino]ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111829512 |
| Molecular Formula | C15H30N6O2 |
| Molecular Weight | 326.45 g/mol |
| Exact Mass | 326.24 |
| IUPAC Name | 1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-3-[2-[di(propan-2-yl)amino]ethyl]-2-methylguanidine |
| SMILES | C/N=C(/NCCN1C(=O)CNC1=O)NCCN(C(C)C)C(C)C |
| InChI | InChI=1S/C15H30N6O2/c1-11(2)20(12(3)4)8-6-17-14(16-5)18-7-9-21-13(22)10-19-15(21)23/h11-12H,6-10H2,1-5H3,(H,19,23)(H2,16,17,18) |
| InChIKey | BOLNBFHWSZZEDY-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 89.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.45 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|