C12H23N5O3 — CID 111828941
1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-3-(3-ethoxypropyl)-2-methylguanidine (PubChem CID 111828941) has the molecular formula C12H23N5O3 and a molecular weight of 285.35 g/mol. Its IUPAC name is 1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-3-(3-ethoxypropyl)-2-methylguanidine.
| Compound Name | 1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-3-(3-ethoxypropyl)-2-methylguanidine |
|---|---|
| PubChem CID | 111828941 |
| Molecular Formula | C12H23N5O3 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | 1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-3-(3-ethoxypropyl)-2-methylguanidine |
| SMILES | CCOCCCN/C(=N\C)NCCN1C(=O)CNC1=O |
| InChI | InChI=1S/C12H23N5O3/c1-3-20-8-4-5-14-11(13-2)15-6-7-17-10(18)9-16-12(17)19/h3-9H2,1-2H3,(H,16,19)(H2,13,14,15) |
| InChIKey | LTPQXWGVWQKAQC-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|