C17H31N5O3 — CID 109390854
1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-3-(3-ethoxy-2,2-diethylcyclobutyl)-2-methylguanidine (PubChem CID 109390854) has the molecular formula C17H31N5O3 and a molecular weight of 353.47 g/mol. Its IUPAC name is 1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-3-(3-ethoxy-2,2-diethylcyclobutyl)-2-methylguanidine.
| Compound Name | 1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-3-(3-ethoxy-2,2-diethylcyclobutyl)-2-methylguanidine |
|---|---|
| PubChem CID | 109390854 |
| Molecular Formula | C17H31N5O3 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.24 |
| IUPAC Name | 1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-3-(3-ethoxy-2,2-diethylcyclobutyl)-2-methylguanidine |
| SMILES | CCOC1CC(N/C(=N/C)NCCN2C(=O)CNC2=O)C1(CC)CC |
| InChI | InChI=1S/C17H31N5O3/c1-5-17(6-2)12(10-13(17)25-7-3)21-15(18-4)19-8-9-22-14(23)11-20-16(22)24/h12-13H,5-11H2,1-4H3,(H,20,24)(H2,18,19,21) |
| InChIKey | QGZSYMVXIDCKMN-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|