C17H37IN4O3S — CID 109390421
1-(3-ethoxy-2,2-diethylcyclobutyl)-3-[3-(ethylsulfonylamino)propyl]-2-methylguanidine;hydroiodide (PubChem CID 109390421) has the molecular formula C17H37IN4O3S and a molecular weight of 504.48 g/mol. Its IUPAC name is 1-(3-ethoxy-2,2-diethylcyclobutyl)-3-[3-(ethylsulfonylamino)propyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-(3-ethoxy-2,2-diethylcyclobutyl)-3-[3-(ethylsulfonylamino)propyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109390421 |
| Molecular Formula | C17H37IN4O3S |
| Molecular Weight | 504.48 g/mol |
| Exact Mass | 504.16 |
| IUPAC Name | 1-(3-ethoxy-2,2-diethylcyclobutyl)-3-[3-(ethylsulfonylamino)propyl]-2-methylguanidine;hydroiodide |
| SMILES | CCOC1CC(N/C(=N/C)NCCCNS(=O)(=O)CC)C1(CC)CC.I |
| InChI | InChI=1S/C17H36N4O3S.HI/c1-6-17(7-2)14(13-15(17)24-8-3)21-16(18-5)19-11-10-12-20-25(22,23)9-4;/h14-15,20H,6-13H2,1-5H3,(H2,18,19,21);1H |
| InChIKey | RMONPXLNYNQZLB-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 91.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.48 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|