C19H36IN5O3 — CID 109390675
1-(3-ethoxy-2,2-diethylcyclobutyl)-3-[[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]methyl]-2-methylguanidine;hydroiodide (PubChem CID 109390675) has the molecular formula C19H36IN5O3 and a molecular weight of 509.43 g/mol. Its IUPAC name is 1-(3-ethoxy-2,2-diethylcyclobutyl)-3-[[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-(3-ethoxy-2,2-diethylcyclobutyl)-3-[[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109390675 |
| Molecular Formula | C19H36IN5O3 |
| Molecular Weight | 509.43 g/mol |
| Exact Mass | 509.19 |
| IUPAC Name | 1-(3-ethoxy-2,2-diethylcyclobutyl)-3-[[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]methyl]-2-methylguanidine;hydroiodide |
| SMILES | CCOC(C)c1noc(CN/C(=N\C)NC2CC(OCC)C2(CC)CC)n1.I |
| InChI | InChI=1S/C19H35N5O3.HI/c1-7-19(8-2)14(11-15(19)26-10-4)22-18(20-6)21-12-16-23-17(24-27-16)13(5)25-9-3;/h13-15H,7-12H2,1-6H3,(H2,20,21,22);1H |
| InChIKey | YGPNBVYBRQZDGQ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 93.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.43 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|