C17H36N4O3S — CID 109390558
1-(3-ethoxy-2,2-diethylcyclobutyl)-3-ethyl-2-[2-(ethylsulfonylamino)ethyl]guanidine (PubChem CID 109390558) has the molecular formula C17H36N4O3S and a molecular weight of 376.57 g/mol. Its IUPAC name is 1-(3-ethoxy-2,2-diethylcyclobutyl)-3-ethyl-2-[2-(ethylsulfonylamino)ethyl]guanidine.
| Compound Name | 1-(3-ethoxy-2,2-diethylcyclobutyl)-3-ethyl-2-[2-(ethylsulfonylamino)ethyl]guanidine |
|---|---|
| PubChem CID | 109390558 |
| Molecular Formula | C17H36N4O3S |
| Molecular Weight | 376.57 g/mol |
| Exact Mass | 376.25 |
| IUPAC Name | 1-(3-ethoxy-2,2-diethylcyclobutyl)-3-ethyl-2-[2-(ethylsulfonylamino)ethyl]guanidine |
| SMILES | CCN/C(=N\CCNS(=O)(=O)CC)NC1CC(OCC)C1(CC)CC |
| InChI | InChI=1S/C17H36N4O3S/c1-6-17(7-2)14(13-15(17)24-9-4)21-16(18-8-3)19-11-12-20-25(22,23)10-5/h14-15,20H,6-13H2,1-5H3,(H2,18,19,21) |
| InChIKey | SWCXXSQSKVTCSH-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 91.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.57 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|